--- search: boost: 5.0 --- # Slot: SMILES _Simplified Molecular Input Line Entry System (SMILES) ASCII-based line notation used to describe chemical structures. It represents molecular graphs with atoms and bonds, allowing software to convert these short strings into 2D or 3D models._
URI: [https://CCPBioSim.ac.uk/biosim-schema/SMILES](https://CCPBioSim.ac.uk/biosim-schema/SMILES) ## Applicable Classes | Name | Description | Modifies Slot | | --- | --- | --- | | [MoleculeID](../classes/MoleculeID.md) | Identifiers of a molecule type in the simulated system | no | ## Properties ### Type and Range | Property | Value | | --- | --- | | Range | [string](../types/string.md) | | Domain Of | [MoleculeID](../classes/MoleculeID.md) | ### Cardinality and Requirements | Property | Value | | --- | --- | ### Value Constraints | Property | Value | | --- | --- | | Regex Pattern | `^[A-Za-z0-9@+\-\[\]()=#$:./\\%*]+$` | ## Aliases * SMILES ## Examples | Value | | --- | | CN1C=NC2=C1C(=O)N(C(=O)N2C)C | ## Identifier and Mapping Information ### Annotations | property | value | | --- | --- | | engine_mapping | [{'engine': 'toptrajparser', 'key': 'SMILES'}] | ### Schema Source * from schema: https://CCPBioSim.ac.uk/biosim-schema/ ## Mappings | Mapping Type | Mapped Value | | --- | --- | | self | https://CCPBioSim.ac.uk/biosim-schema/SMILES | | native | https://CCPBioSim.ac.uk/biosim-schema/SMILES | ## LinkML Source ```yaml name: SMILES annotations: engine_mapping: tag: engine_mapping value: - engine: toptrajparser key: SMILES description: Simplified Molecular Input Line Entry System (SMILES) ASCII-based line notation used to describe chemical structures. It represents molecular graphs with atoms and bonds, allowing software to convert these short strings into 2D or 3D models. examples: - value: CN1C=NC2=C1C(=O)N(C(=O)N2C)C from_schema: https://CCPBioSim.ac.uk/biosim-schema/ aliases: - SMILES rank: 1000 domain_of: - MoleculeID range: string pattern: ^[A-Za-z0-9@+\-\[\]()=#$:./\\%*]+$ ```