--- search: boost: 5.0 --- # Slot: InChI _The International Chemical Identifier (InChi) is a textual identifier for chemical substances, designed to provide a standard way to encode molecular information_
URI: [https://CCPBioSim.ac.uk/biosim-schema/InChI](https://CCPBioSim.ac.uk/biosim-schema/InChI) ## Applicable Classes | Name | Description | Modifies Slot | | --- | --- | --- | | [MoleculeID](../classes/MoleculeID.md) | Identifiers of a molecule type in the simulated system | no | ## Properties ### Type and Range | Property | Value | | --- | --- | | Range | [string](../types/string.md) | | Domain Of | [MoleculeID](../classes/MoleculeID.md) | ### Cardinality and Requirements | Property | Value | | --- | --- | ### Value Constraints | Property | Value | | --- | --- | | Regex Pattern | `^InChI=1S?/[A-Za-z0-9.+\-]+(/[a-z][^/]*)*$` | ## Aliases * InChI ## Examples | Value | | --- | | InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 | ## Identifier and Mapping Information ### Annotations | property | value | | --- | --- | | engine_mapping | [{'engine': 'toptrajparser', 'key': 'InChI'}] | ### Schema Source * from schema: https://CCPBioSim.ac.uk/biosim-schema/ ## Mappings | Mapping Type | Mapped Value | | --- | --- | | self | https://CCPBioSim.ac.uk/biosim-schema/InChI | | native | https://CCPBioSim.ac.uk/biosim-schema/InChI | ## LinkML Source ```yaml name: InChI annotations: engine_mapping: tag: engine_mapping value: - engine: toptrajparser key: InChI description: The International Chemical Identifier (InChi) is a textual identifier for chemical substances, designed to provide a standard way to encode molecular information examples: - value: InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 from_schema: https://CCPBioSim.ac.uk/biosim-schema/ aliases: - InChI rank: 1000 domain_of: - MoleculeID range: string pattern: ^InChI=1S?/[A-Za-z0-9.+\-]+(/[a-z][^/]*)*$ ```